CAS 7250-19-3
:1H-Indol-3-amine
Description:
1H-Indol-3-amine, also known as tryptamine, is an organic compound characterized by its indole structure with an amino group at the 3-position. It is a colorless to pale yellow solid that is soluble in water and organic solvents. This compound is notable for its role as a biological precursor to various neurotransmitters, including serotonin, and is involved in several physiological processes. The presence of the amino group contributes to its basicity, allowing it to participate in various chemical reactions, such as acylation and alkylation. 1H-Indol-3-amine exhibits moderate stability under standard conditions but can undergo oxidation or other transformations when exposed to strong oxidizing agents. It is also of interest in medicinal chemistry due to its potential therapeutic applications, including its influence on mood and cognition. Additionally, its derivatives are studied for their pharmacological properties, making it a compound of significant interest in both organic chemistry and biochemistry.
Formula:C8H8N2
InChI:InChI=1S/C8H8N2/c9-7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,9H2
InChI key:InChIKey=TXQAZWIBPGKHOX-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC=CC2)NC1
Synonyms:- NSC 24933
- 3-Aminoindole
- Indole, 3-amino-
- 1H-Indol-3-amine
- 1H-Indol-3-yl amine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.