CAS 7250-28-4
:4-methyl-1-(2-oxo-2-phenylethyl)pyridinium
Description:
4-Methyl-1-(2-oxo-2-phenylethyl)pyridinium, with the CAS number 7250-28-4, is a chemical compound that features a pyridinium ring, which is a six-membered aromatic heterocycle containing nitrogen. This compound is characterized by the presence of a methyl group at the 4-position of the pyridine ring and a phenyl group attached to a carbonyl moiety at the 1-position. The structure suggests that it may exhibit both basic and acidic properties due to the pyridinium nitrogen and the carbonyl functionality, respectively. It is likely to be soluble in polar solvents, given the presence of the pyridinium ion, which can engage in hydrogen bonding. The compound may also display interesting reactivity due to the electrophilic nature of the carbonyl group, making it a potential candidate for various chemical reactions, including nucleophilic additions. Additionally, its unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H14BrNO
InChI:InChI=1/C14H14NO/c1-12-7-9-15(10-8-12)11-14(16)13-5-3-2-4-6-13/h2-10H,11H2,1H3/q+1
SMILES:CC1C=CN(C=C1)CC(=O)c1ccccc1
Synonyms:- Pyridinium, 4-methyl-1-(2-oxo-2-phenylethyl)-
- 4-Methyl-1-(2-oxo-2-phenylethyl)pyridinium
- 4-Methyl-1-(2-oxo-2-phenylethyl)pyridin-1-ium bromide
- 4-METHYL-1-(2-OXO-2-PHENYL-ETHYL)-PYRIDINIUM, BROMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
