CAS 7250-62-6
:(2,4-dibromo-6-methylphenoxy)acetic acid
Description:
(2,4-Dibromo-6-methylphenoxy)acetic acid, with the CAS number 7250-62-6, is an organic compound that belongs to the class of phenoxyacetic acids. It features a phenoxy group, which is a phenol derivative where a hydrogen atom is replaced by an acetic acid moiety. The presence of two bromine atoms at the 2 and 4 positions and a methyl group at the 6 position on the phenyl ring contributes to its unique chemical properties. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many halogenated organic compounds. It exhibits herbicidal properties, making it useful in agricultural applications for weed control. The presence of bromine atoms enhances its biological activity and stability. Additionally, it may undergo various chemical reactions typical of carboxylic acids, such as esterification and neutralization. Safety data should be consulted for handling and exposure, as halogenated compounds can pose environmental and health risks.
Formula:C9H8Br2O3
InChI:InChI=1/C9H8Br2O3/c1-5-2-6(10)3-7(11)9(5)14-4-8(12)13/h2-3H,4H2,1H3,(H,12,13)
Synonyms:- acetic acid, 2-(2,4-dibromo-6-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.