CAS 7250-75-1
:5,5-Dicyclopropylhydantoin
Description:
5,5-Dicyclopropylhydantoin is an organic compound characterized by its unique structure, which includes two cyclopropyl groups attached to the nitrogen atoms of a hydantoin ring. This compound is typically a white to off-white crystalline solid and is known for its stability and low solubility in water, making it more soluble in organic solvents. It is primarily used in the field of organic synthesis and as a reagent in various chemical reactions. The presence of the cyclopropyl groups contributes to its distinctive chemical properties, including potential applications in pharmaceuticals and agrochemicals. Additionally, 5,5-Dicyclopropylhydantoin may exhibit interesting biological activities, although specific studies on its pharmacological effects are limited. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use. Overall, this compound represents a fascinating example of how structural modifications can influence the properties and applications of organic molecules.
Formula:C9H12N2O2
InChI:InChI=1/C9H12N2O2/c12-7-9(5-1-2-5,6-3-4-6)11-8(13)10-7/h5-6H,1-4H2,(H2,10,11,12,13)
SMILES:C1CC1C1(C2CC2)C(=NC(=N1)O)O
Synonyms:- 5,5-Dicyclopropyldantoin
- 5,5-Dicyclopropylimidazolidine-2,4-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5,5-Dicyclopropylimidazolidine-2,4-dione
CAS:5,5-Dicyclopropylimidazolidine-2,4-dione is an ammonium salt that has a strong antispasmodic effect. It is used to treat muscle spasms and other types of spasticity. 5,5-Dicyclopropylimidazolidine-2,4-dione also has an alkali metal (e.g., sodium) or alkali earth metal (e.g., magnesium) salt form that can be used for the treatment of cystitis, pyelonephritis, and other urinary tract infections. This compound is converted to the corresponding hydantoin derivative in vivo by hydrolysis of the ethoxide group. Hydantoins are related to the hydantoin class of nonsteroidal anti-inflammatory drugs (NSAIDs).
Formula:C9H12N2O2Purity:Min. 95%Molecular weight:180.2 g/mol

