
CAS 72500-37-9
:α-[(Aminocarbonyl)amino]-4-hydroxybenzeneacetic acid
Description:
α-[(Aminocarbonyl)amino]-4-hydroxybenzeneacetic acid, also known by its CAS number 72500-37-9, is a chemical compound characterized by its structural features that include an amino group, a carbonyl group, and a hydroxy group attached to a benzene ring. This compound is classified as an amino acid derivative, which suggests it may exhibit properties typical of both amino acids and aromatic compounds. Its molecular structure allows for potential hydrogen bonding due to the presence of the hydroxyl group, which can influence its solubility and reactivity. The aminocarbonyl group contributes to its potential as a building block in peptide synthesis or as a pharmaceutical intermediate. Additionally, the presence of the hydroxy group may impart antioxidant properties, making it of interest in biochemical applications. Overall, this compound's unique functional groups and structural characteristics make it a subject of interest in medicinal chemistry and related fields.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c10-9(15)11-7(8(13)14)5-1-3-6(12)4-2-5/h1-4,7,12H,(H,13,14)(H3,10,11,15)
InChI key:InChIKey=GSHIDXLOTQDUAV-UHFFFAOYSA-N
SMILES:C(NC(N)=O)(C(O)=O)C1=CC=C(O)C=C1
Synonyms:- N-Carbamoyl-p-hydroxy-DL-phenylglycine
- 2-(Carbamoylamino)-2-(4-hydroxyphenyl)acetic acid
- (±)-N-Carbamoyl-2-(p-hydroxyphenyl)glycine
- Benzeneacetic acid, α-[(aminocarbonyl)amino]-4-hydroxy-
- α-[(Aminocarbonyl)amino]-4-hydroxybenzeneacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.