CAS 72503-79-8

Istamycin A

Description:

Istamycin A is a natural product belonging to the class of antibiotics, specifically derived from the fermentation of certain Streptomyces species. It exhibits a complex molecular structure characterized by a unique bicyclic core, which contributes to its biological activity. This compound is known for its potent antibacterial properties, particularly against Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic research. Istamycin A functions by inhibiting bacterial protein synthesis, thereby disrupting essential cellular processes. Its mechanism of action and structural features have been the subject of various studies aimed at understanding its efficacy and potential applications in treating bacterial infections. Additionally, the compound's stability, solubility, and pharmacokinetic properties are crucial for its development as a therapeutic agent. Ongoing research continues to explore its derivatives and analogs to enhance its effectiveness and reduce potential side effects. Overall, Istamycin A represents a significant contribution to the arsenal of antimicrobial agents in the fight against resistant bacterial strains.

Formula: C₁₇H₃₅N₅O₅

InChI: InChI=1S/C17H35N5O5/c1-21-8-9-4-5-10(19)17(26-9)27-16-11(20)6-12(25-3)14(15(16)24)22(2)13(23)7-18/h9-12,14-17,21,24H,4-8,18-20H2,1-3H3/t9-,10+,11-,12-,14+,15+,16+,17+/m0/s1

InChI key: InChIKey=NEFDRWXEVITQMN-JWYRXTSNSA-N

SMILES: N(C(CN)=O)(C)[C@@H]1[C@@H](OC)C[C@H](N)[C@@H](O[C@H]2O[C@H](CNC)CC[C@H]2N)[C@@H]1O

Synonyms:

• Istamycin A
• L-chiro-Inositol, 4-amino-1-[(aminoacetyl)methylamino]-3-O-[2-amino-2,3,4,6-tetradeoxy-6-(methylamino)-α-D-erythro-hexopyranosyl]-1,4,5-trideoxy-6-O-methyl-
• L-chiro-Inositol, 4-amino-1-[(2-aminoacetyl)methylamino]-3-O-[2-amino-2,3,4,6-tetradeoxy-6-(methylamino)-α-D-erythro-hexopyranosyl]-1,4,5-trideoxy-6-O-methyl-
• Sannamycin A
• 4-Amino-1-[(2-aminoacetyl)methylamino]-3-O-[2-amino-2,3,4,6-tetradeoxy-6-(methylamino)-α-D-erythro-hexopyranosyl]-1,4,5-trideoxy-6-O-methyl-L-chiro-inositol

Sannamycin A

CAS: 72503-79-8

Sannamycin A is an antibiotic.

Formula: C₁₇H₃₅N₅O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 389.497

Ref: TM-T24757