
CAS 72503-80-1
:Istamycin A0
Description:
Istamycin A0, with the CAS number 72503-80-1, is a natural product belonging to the class of antibiotics known as macrolides. It is derived from the fermentation of certain Streptomyces species. This compound exhibits notable antibacterial activity, particularly against a range of Gram-positive bacteria, making it of interest in the field of medicinal chemistry and pharmacology. Istamycin A0 is characterized by its complex macrolide structure, which typically includes a large lactone ring and various functional groups that contribute to its biological activity. The compound's mechanism of action generally involves inhibition of protein synthesis in bacterial cells, which is a common feature among macrolide antibiotics. Additionally, Istamycin A0 may possess unique properties that differentiate it from other macrolides, such as specific resistance profiles or synergistic effects when used in combination with other antimicrobial agents. Research into Istamycin A0 continues to explore its potential therapeutic applications and the development of derivatives that may enhance its efficacy and reduce resistance.
Formula:C15H32N4O4
InChI:InChI=1S/C15H32N4O4/c1-18-7-8-4-5-9(16)15(22-8)23-14-10(17)6-11(21-3)12(19-2)13(14)20/h8-15,18-20H,4-7,16-17H2,1-3H3
InChI key:InChIKey=GKYYNFPFPFRFFN-UHFFFAOYSA-N
SMILES:O(C1C(O)C(NC)C(OC)CC1N)C2OC(CNC)CCC2N
Synonyms:- Istamycin A0
- L-chiro-Inositol, 4-amino-3-O-[2-amino-2,3,4,6-tetradeoxy-6-(methylamino)-α-D-erythro-hexopyranosyl]-1,4,5-trideoxy-6-O-methyl-1-(methylamino)-
- Antibiotic KA 7038III
- Sannamycin B
- 4-Amino-3-O-[2-amino-2,3,4,6-tetradeoxy-6-(methylamino)-α-D-erythro-hexopyranosyl]-1,4,5-trideoxy-6-O-methyl-1-(methylamino)-L-chiro-inositol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sannamycin B
CAS:Sannamycin B is a bioactive chemical.Formula:C15H32N4O4Color and Shape:SolidMolecular weight:332.44
