CAS 72505-21-6
:4-(Trifluoromethyl)benzenecarbothioamide
Description:
4-(Trifluoromethyl)benzenecarbothioamide, with the CAS number 72505-21-6, is an organic compound characterized by the presence of a trifluoromethyl group (-CF3) attached to a benzene ring, along with a carbothioamide functional group (-C(S)NH2). This compound typically exhibits properties associated with both aromatic and thioamide functionalities, including potential reactivity due to the presence of the sulfur atom. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's overall stability and reactivity. As a thioamide, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's structure suggests it may have applications in pharmaceuticals or agrochemicals, particularly due to the trifluoromethyl moiety, which is often associated with increased biological activity. Additionally, its physical properties, such as solubility and melting point, would be influenced by the balance of hydrophobic and polar characteristics imparted by its functional groups.
Formula:C8H6F3NS
InChI:InChI=1S/C8H6F3NS/c9-8(10,11)6-3-1-5(2-4-6)7(12)13/h1-4H,(H2,12,13)
InChI key:InChIKey=IPRFNMJROWWFBH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(C(N)=S)C=C1
Synonyms:- 4-(Trifluoromethyl)benzene-1-carbothioamide
- 4-(Trifluoromethyl)benzenecarbothioamide
- 4-(Trifluoromethyl)benzothioamide
- 4-[(Trifluoromethyl)-thio]-benzamide
- Benzenecarbothioamide, 4-(trifluoromethyl)-
- p-(Trifluoromethyl)thiobenzamide
- 4-(Trifluoromethyl)thiobenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-(Trifluoromethyl)thiobenzamide
CAS:Formula:C8H6F3NSPurity:98%Color and Shape:SolidMolecular weight:205.20014-(Trifluoromethyl)thiobenzamide
CAS:4-(Trifluoromethyl)thiobenzamidePurity:98%Color and Shape:Yellow PowderMolecular weight:205.20g/mol4-(Trifluoromethyl)thiobenzamide
CAS:Formula:C8H6F3NSPurity:>98.0%(HPLC)Color and Shape:Light yellow to Yellow to Green powder to crystalMolecular weight:205.204-(Trifluoromethyl)thiobenzamide
CAS:Formula:C8H6F3NSPurity:97.0%Color and Shape:Off-white to yellow powderMolecular weight:205.24-Trifluoromethylbenzene-1-carbothioamide
CAS:4-Trifluoromethylbenzene-1-carbothioamide (4FBA) is a non-toxic, organosulfur compound that is found in the fructus of Aurantii or Garcinia mangostana. 4FBA inhibits oxidant enzymes by reacting with their sulfhydryl groups and, as a result, prevents oxidation of other molecules. It has been shown to have antioxidant properties and inhibitory activity against two important enzymes that are involved in the progression of oxidative stress and inflammation. 4FBA has also been shown to be an effective inhibitor of chloride channels which may provide therapeutic potential for diseases such as sclerosis.Formula:C8H6F3NSPurity:Min. 95%Color and Shape:PowderMolecular weight:205.2 g/mol4-(Trifluoromethyl)thiobenzamide
CAS:Controlled ProductFormula:C8H6F3NSColor and Shape:NeatMolecular weight:205.2






