CAS 7251-14-1
:2,5-bis(aziridin-1-yl)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione
Description:
2,5-bis(aziridin-1-yl)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione, with CAS number 7251-14-1, is a synthetic organic compound characterized by its unique structure that includes aziridine rings and a cyclohexa-2,5-diene-1,4-dione moiety. This compound features two aziridine groups, which are three-membered nitrogen-containing heterocycles known for their reactivity, particularly in nucleophilic and electrophilic reactions. The presence of dichloro substituents on the cyclohexadiene core enhances its electrophilic character, making it potentially useful in various chemical transformations. The compound may exhibit biological activity, as many aziridine derivatives are known for their applications in medicinal chemistry, particularly as potential anticancer agents due to their ability to interact with DNA. Additionally, its structural features suggest potential applications in polymer chemistry and materials science. However, specific properties such as solubility, melting point, and stability would require empirical data for precise characterization. Safety and handling precautions should be observed due to the reactive nature of aziridine-containing compounds.
Formula:C10H8Cl2N2O2
InChI:InChI=1/C10H8Cl2N2O2/c11-5-7(13-1-2-13)9(15)6(12)8(10(5)16)14-3-4-14/h1-4H2
Synonyms:- 2,5-cyclohexadiene-1,4-dione, 2,5-bis(1-aziridinyl)-3,6-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
