CymitQuimica logo

CAS 7251-82-3

:

4-methyl-1H-isoindole-1,3(2H)-dione

Description:
4-Methyl-1H-isoindole-1,3(2H)-dione, also known as phthalimide, is a heterocyclic organic compound characterized by its isoindole structure, which features a five-membered ring containing nitrogen and carbon atoms. This compound is typically a white to off-white crystalline solid that is relatively stable under standard conditions. It is known for its solubility in organic solvents such as acetone and chloroform, but it is less soluble in water. The presence of the methyl group at the 4-position contributes to its unique reactivity and properties. Phthalimide is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its ability to undergo nucleophilic substitution reactions. Additionally, it serves as a precursor for the synthesis of other compounds, including dyes and polymers. Its derivatives have applications in medicinal chemistry, highlighting its importance in both industrial and research settings. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H7NO2
InChI:InChI=1/C9H7NO2/c1-5-3-2-4-6-7(5)9(12)10-8(6)11/h2-4H,1H3,(H,10,11,12)
SMILES:Cc1cccc2c1C(=O)N=C2O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.