CymitQuimica logo

CAS 72517-44-3

:

dansylsarcosine piperidinium

Description:
Dansylsarcosine piperidinium, identified by its CAS number 72517-44-3, is a synthetic compound that belongs to the class of dansyl derivatives, which are known for their fluorescent properties. This substance is characterized by the presence of a dansyl group, which is a sulfonamide moiety that imparts strong fluorescence, making it useful in various biochemical applications, particularly in labeling and tracking biomolecules. The piperidinium component contributes to its solubility and stability in aqueous environments. Dansylsarcosine piperidinium is often utilized in studies involving protein interactions, enzyme activity, and cellular imaging due to its ability to selectively bind to certain biomolecules. Its fluorescence can be excited by UV light, allowing for visualization in laboratory settings. Additionally, the compound may exhibit specific biological activities, although detailed pharmacological profiles may vary. Overall, its unique structural features and fluorescent properties make it a valuable tool in chemical and biological research.
Formula:C20H29N3O4S
InChI:InChI=1/C15H18N2O4S.C5H11N/c1-16(2)13-8-4-7-12-11(13)6-5-9-14(12)22(20,21)17(3)10-15(18)19;1-2-4-6-5-3-1/h4-9H,10H2,1-3H3,(H,18,19);6H,1-5H2
SMILES:CN(C)c1cccc2c1cccc2S(=O)(=O)N(C)CC(=O)O.C1CCNCC1
Synonyms:
  • Dansyl sarcosine piperidinium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.