CAS 72518-42-4
:2-Phenyl-2-piperidinecarboxylic acid
Description:
2-Phenyl-2-piperidinecarboxylic acid, with the CAS number 72518-42-4, is an organic compound characterized by its piperidine ring structure substituted with a phenyl group and a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, though its solubility in water may be limited due to the hydrophobic nature of the phenyl group. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the piperidine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on further research. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with exposure.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c14-11(15)12(8-4-5-9-13-12)10-6-2-1-3-7-10/h1-3,6-7,13H,4-5,8-9H2,(H,14,15)
InChI key:InChIKey=ROLZGXIJZZQJSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCCCN1)C2=CC=CC=C2
Synonyms:- 2-Phenyl-2-piperidinecarboxylic acid
- 2-Piperidinecarboxylic acid, 2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
