CymitQuimica logo

CAS 7252-02-0

:

4-(3,4-dihydroisoquinolin-2(1H)-ylsulfonyl)aniline

Description:
4-(3,4-Dihydroisoquinolin-2(1H)-ylsulfonyl)aniline is a chemical compound characterized by its unique structure, which includes a sulfonyl group attached to an aniline moiety and a dihydroisoquinoline ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the sulfonyl group can enhance solubility and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which may lead to pharmacological effects. The compound is likely to be a solid at room temperature, with moderate stability under standard conditions. Additionally, it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.
Formula:C15H16N2O2S
InChI:InChI=1/C15H16N2O2S/c16-14-5-7-15(8-6-14)20(18,19)17-10-9-12-3-1-2-4-13(12)11-17/h1-8H,9-11,16H2
SMILES:c1ccc2CN(CCc2c1)S(=O)(=O)c1ccc(cc1)N
Synonyms:
  • benzenamine, 4-[(3,4-dihydro-2(1H)-isoquinolinyl)sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.