CAS 7252-90-6
:4,4'-hex-2-yne-1,6-diyldimorpholine
Description:
4,4'-Hex-2-yne-1,6-diyldimorpholine, with the CAS number 7252-90-6, is a chemical compound that features a unique structure characterized by a hex-2-yne backbone and two morpholine rings. Morpholine is a heterocyclic amine, which contributes to the compound's potential solubility in polar solvents and its ability to participate in various chemical reactions. The presence of the alkyne functional group (hex-2-yne) suggests that this compound may exhibit reactivity typical of alkynes, such as undergoing addition reactions. Additionally, the dimorpholine substituents may impart specific properties, such as increased stability or unique interactions with other molecules. This compound may be of interest in organic synthesis, materials science, or medicinal chemistry due to its structural features. However, detailed information regarding its physical properties, such as boiling point, melting point, and specific reactivity, would require further investigation or experimental data. Safety data should also be consulted, as compounds containing morpholine can pose health risks.
Formula:C14H24N2O2
InChI:InChI=1/C14H24N2O2/c1(3-5-15-7-11-17-12-8-15)2-4-6-16-9-13-18-14-10-16/h1,3,5-14H2
SMILES:C(C#CCN1CCOCC1)CCN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.