CAS 72520-92-4
:Paeonolide
Description:
Paeonolide, with the CAS number 72520-92-4, is a natural compound primarily derived from the roots of the peony plant, particularly Paeonia lactiflora. It is classified as a monoterpene glycoside and is known for its potential therapeutic properties. Paeonolide exhibits anti-inflammatory, analgesic, and antioxidant activities, making it of interest in pharmacological research. The compound is characterized by its unique chemical structure, which includes a sugar moiety attached to a phenolic backbone. This structure contributes to its biological activity and solubility properties. In addition to its medicinal uses, paeonolide is also studied for its effects on various cellular pathways, including those involved in pain and inflammation. Its safety profile and efficacy are subjects of ongoing research, particularly in traditional medicine contexts. Overall, paeonolide represents a significant compound in the study of natural products and their applications in health and wellness.
Formula:C20H28O12
InChI:InChI=1S/C20H28O12/c1-8(21)10-4-3-9(28-2)5-12(10)31-20-18(27)16(25)15(24)13(32-20)7-30-19-17(26)14(23)11(22)6-29-19/h3-5,11,13-20,22-27H,6-7H2,1-2H3/t11-,13+,14-,15+,16-,17+,18+,19-,20+/m0/s1
InChI key:InChIKey=IDZZECHGWAZTIB-NYBIBFQCSA-N
SMILES:O(C1=C(C(C)=O)C=CC(OC)=C1)[C@@H]2O[C@H](CO[C@H]3[C@H](O)[C@@H](O)[C@@H](O)CO3)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- 1-[2-[(6-O-α-<span class="text-smallcaps">L</smallcap>-Arabinopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-4-methoxyphenyl]ethanone
- Ethanone, 1-[2-[(6-O-α-<span class="text-smallcaps">L</smallcap>-arabinopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-4-methoxyphenyl]-
- Glucopyranoside, 2-acetyl-5-methoxyphenyl O-α-<span class="text-smallcaps">L</smallcap>-arabinosyl-, β-<smallcap>D</span>-
- Paeonolide
- Ethanone, 1-[2-[(6-O-α-L-arabinopyranosyl-β-D-glucopyranosyl)oxy]-4-methoxyphenyl]-
- Glucopyranoside, 2-acetyl-5-methoxyphenyl O-α-L-arabinosyl-, β-D-
- 1-[2-[(6-O-α-L-Arabinopyranosyl-β-D-glucopyranosyl)oxy]-4-methoxyphenyl]ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Paeonolide
CAS:Formula:C20H28O12Purity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:460.43Paeonolide
CAS:Paeonolide is a plant glycoside predominantly found in the roots of Paeonia genus plants, characterized by a non-reducing terminal α-1-arabino pyranoside.Formula:C20H28O12Purity:99.96% - ≥95%Color and Shape:SolidMolecular weight:460.43Ref: TM-T6S1657
1mg50.00€5mg98.00€1mL*10mM (DMSO)101.00€10mg166.00€25mg268.00€50mg408.00€100mg590.00€Paeonolide
CAS:Paeonolide is a naturally occurring bioactive compound that is classified as a phenolic glycoside, which is extracted from the roots of plants in the Paeonia genus, commonly known as peonies. This compound is characterized by its unique mode of action, which primarily involves anti-inflammatory and antioxidant activities. Paeonolide is known to inhibit the expression of pro-inflammatory cytokines and modulate various signaling pathways involved in inflammatory responses.
Formula:C20H28O12Purity:Min. 95%Molecular weight:460.43 g/mol







