CAS 72521-00-7

5-Methyl-6-nitro-1H-indazole

Description:

5-Methyl-6-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methyl group at the 5-position and a nitro group at the 6-position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, which may include ethanol and dimethyl sulfoxide (DMSO), but has limited solubility in water. It is often used in research settings, particularly in the fields of medicinal chemistry and pharmacology, due to its potential biological activities. The nitro group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. As with many nitro compounds, it may pose certain safety hazards, including potential toxicity and environmental concerns, necessitating careful handling and disposal. Overall, 5-Methyl-6-nitro-1H-indazole is a compound of interest for its structural features and potential applications in scientific research.

Formula: C₈H₇N₃O₂

InChI: InChI=1/C8H7N3O2/c1-5-2-6-4-9-10-7(6)3-8(5)11(12)13/h2-4H,1H3,(H,9,10)

SMILES: Cc1cc2c[nH]nc2cc1N(=O)=O

Synonyms:

• 1H-indazole, 5-methyl-6-nitro-

6-NITRO-5-METHYL (1H)INDAZOLE

CAS: 72521-00-7

Formula: C₈H₇N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 177.1601

Ref: IN-DA00FBFE

5-Methyl-6-nitro-1H-indazole

CAS: 72521-00-7

5-Methyl-6-nitro-1H-indazole

Purity: 97%

Molecular weight: 177.16g/mol

Ref: 54-OR948085

5-Methyl-6-nitro-1H-indazole

CAS: 72521-00-7

Formula: C₈H₇N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 177.054

Ref: 10-F337877