CAS 725211-89-2
:1-[1-(furan-2-ylmethyl)piperidin-4-yl]methanamine
Description:
1-[1-(Furan-2-ylmethyl)piperidin-4-yl]methanamine, with the CAS number 725211-89-2, is a chemical compound characterized by its unique structure that includes a piperidine ring substituted with a furan moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. The furan ring contributes to its aromatic characteristics, potentially influencing its reactivity and interaction with biological systems. The presence of the piperidine ring suggests that it may exhibit properties relevant to pharmacology, including potential neuroactive effects. Solubility in polar solvents is likely, given the amine group, while the furan ring may enhance lipophilicity. The compound's structure may allow for various interactions, making it of interest in medicinal chemistry for the development of therapeutic agents. Overall, its unique combination of functional groups positions it as a candidate for further research in drug discovery and development.
Formula:C11H18N2O
InChI:InChI=1/C11H18N2O/c12-8-10-3-5-13(6-4-10)9-11-2-1-7-14-11/h1-2,7,10H,3-6,8-9,12H2
SMILES:c1cc(CN2CCC(CC2)CN)oc1
Synonyms:- 4-Piperidinemethanamine, 1-(2-Furanylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
