CymitQuimica logo

CAS 725212-69-1

:

1-[1-(2-phenylethyl)piperidin-3-yl]methanamine

Description:
1-[1-(2-phenylethyl)piperidin-3-yl]methanamine, with the CAS number 725212-69-1, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenylethyl group attached to the piperidine nitrogen, contributing to its potential biological activity. The presence of the methanamine functional group indicates that it has an amine functionality, which can participate in hydrogen bonding and may influence its solubility and reactivity. The structure suggests that it may exhibit properties relevant to pharmacology, particularly in the context of central nervous system activity, due to the piperidine and phenylethyl moieties, which are often associated with psychoactive compounds. Its molecular interactions, stability, and potential applications would depend on its specific stereochemistry and the presence of functional groups, making it a subject of interest in medicinal chemistry and drug development.
Formula:C14H22N2
InChI:InChI=1/C14H22N2/c15-11-14-7-4-9-16(12-14)10-8-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12,15H2
SMILES:c1ccc(cc1)CCN1CCCC(CN)C1
Synonyms:
  • C-(1-Phenethyl-piperidin-3-yl)-methylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.