CymitQuimica logo

CAS 725217-61-8

:

2-(1,3-Benzodioxol-5-yl)-7-chloro-8-methyl-4-quinolinecarboxylic acid

Description:
2-(1,3-Benzodioxol-5-yl)-7-chloro-8-methyl-4-quinolinecarboxylic acid, with CAS number 725217-61-8, is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a benzodioxole moiety and a carboxylic acid functional group. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the chloro and methyl substituents that can influence its reactivity and interaction with biological targets. The benzodioxole group may contribute to its pharmacological profile, enhancing solubility or modulating biological activity. In terms of physical properties, it is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, which is common for many quinoline derivatives. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry research for developing new therapeutic agents.
Formula:C18H12ClNO4
InChI:InChI=1S/C18H12ClNO4/c1-9-13(19)4-3-11-12(18(21)22)7-14(20-17(9)11)10-2-5-15-16(6-10)24-8-23-15/h2-7H,8H2,1H3,(H,21,22)
InChI key:InChIKey=WMTJCZAPYPGFLS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C=3C=C4C(=CC3)OCO4)C(C)=C(Cl)C=C2
Synonyms:
  • 2-(1,3-Benzodioxol-5-yl)-7-chloro-8-methyl-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 2-(1,3-benzodioxol-5-yl)-7-chloro-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.