CAS 725217-86-7

5-[1-(4-fluorophenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-Fluorophenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of a 4-fluorophenoxyethyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The compound is likely to exhibit properties typical of triazoles, such as antifungal or antimicrobial activity, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of new therapeutic agents. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or environmental impact.

Formula: C₁₁H₁₂FN₃OS

InChI: InChI=1/C11H12FN3OS/c1-7(10-13-14-11(17)15(10)2)16-9-5-3-8(12)4-6-9/h3-7H,1-2H3,(H,14,17)

SMILES: CC(c1nnc(n1C)S)Oc1ccc(cc1)F

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[1-(4-fluorophenoxy)ethyl]-4-methyl-

5-[1-(4-fluorophenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 725217-86-7

Formula: C₁₁H₁₂FN₃OS

Purity: 95.0%

Molecular weight: 253.3

Ref: 10-F307819