CAS 725217-88-9

5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole structure, which includes a thione functional group. This compound features a 4-fluorophenoxyethyl substituent and an allyl group, contributing to its potential biological activity. The presence of the triazole ring suggests that it may exhibit properties relevant to pharmaceuticals, particularly in antifungal or antimicrobial applications. The fluorine atom in the phenoxy group can enhance lipophilicity and biological activity, while the thione group may participate in various chemical reactions, including coordination with metal ions. The compound's molecular structure indicates it may have specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound represents a class of triazole derivatives that could be explored for their therapeutic potential.

Formula: C₁₃H₁₄FN₃OS

InChI: InChI=1/C13H14FN3OS/c1-3-8-17-12(15-16-13(17)19)9(2)18-11-6-4-10(14)5-7-11/h3-7,9H,1,8H2,2H3,(H,16,19)

SMILES: C=CCn1c(C(C)Oc2ccc(cc2)F)nnc1S

4-allyl-5-[1-(4-fluorophenoxy)ethyl]-4H-1,2,4-triazole-3-thiol

CAS: 725217-88-9

Formula: C₁₃H₁₄FN₃OS

Purity: 95.0%

Molecular weight: 279.33

Ref: 10-F307821