CAS 725218-33-7

5-(2-methylfuran-3-yl)-4-propyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(2-Methylfuran-3-yl)-4-propyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structure, which includes a triazole ring and a thione functional group. This compound features a 2-methylfuran moiety, contributing to its aromatic properties, and a propyl group that enhances its hydrophobic characteristics. The presence of the thione group indicates potential reactivity, particularly in coordination chemistry and biological applications. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's solubility and stability in various solvents can influence its behavior in chemical reactions and biological systems. Overall, 5-(2-methylfuran-3-yl)-4-propyl-2,4-dihydro-3H-1,2,4-triazole-3-thione represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₃N₃OS

InChI: InChI=1/C10H13N3OS/c1-3-5-13-9(11-12-10(13)15)8-4-6-14-7(8)2/h4,6H,3,5H2,1-2H3,(H,12,15)

SMILES: CCCn1c(c2ccoc2C)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(2-methyl-3-furanyl)-4-propyl-
• 5-(2-Methyl-3-furyl)-4-propyl-4H-1,2,4-triazole-3-thiol

5-(2-methyl-3-furyl)-4-propyl-4H-1,2,4-triazole-3-thiol

CAS: 725218-33-7

Formula: C₁₀H₁₃N₃OS

Purity: 95.0%

Molecular weight: 223.29

Ref: 10-F307696