CAS 72522-16-8

Pentanoic acid, 4-amino-5-fluoro-, hydrochloride, (S)-

Description:

Pentanoic acid, 4-amino-5-fluoro-, hydrochloride, (S)-, is a chemical compound characterized by its specific functional groups and stereochemistry. It features a pentanoic acid backbone, which is a five-carbon straight-chain carboxylic acid, with an amino group and a fluorine atom substituent at the 4th and 5th positions, respectively. The presence of the hydrochloride indicates that it is in its salt form, typically enhancing its solubility in water and stability. The (S)- designation denotes that the compound has a specific stereochemistry, which can influence its biological activity and interactions. This compound may exhibit properties typical of both amino acids and carboxylic acids, such as being polar and capable of forming hydrogen bonds. Its applications could span various fields, including pharmaceuticals, where it may serve as an intermediate or active ingredient in drug formulations. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₅H₁₀FNO₂·ClH

InChI: InChI=1S/C5H10FNO2.ClH/c6-3-4(7)1-2-5(8)9;/h4H,1-3,7H2,(H,8,9);1H/t4-;/m0./s1

InChI key: InChIKey=HJMZBGJRFDAOQO-WCCKRBBISA-N

SMILES: [C@H](CCC(O)=O)(CF)N.Cl

Synonyms:

• (4S)-4-Amino-5-fluoropentanoic acid hydrochloride
• Pentanoic acid, 4-amino-5-fluoro-, hydrochloride, (S)-

(4S)-4-Amino-5-fluoropentanoic acid hydrochloride

CAS: 72522-16-8

Versatile small molecule scaffold

Formula: C₅H₁₁ClFNO₂

Purity: Min. 95%

Molecular weight: 171.6 g/mol

Ref: 3D-XCA52216