CAS 72522-40-8
:7-hydroxy-4,6-dimethylnonan-3-one
Description:
7-Hydroxy-4,6-dimethylnonan-3-one, with the CAS number 72522-40-8, is an organic compound characterized by its ketone functional group and hydroxyl group. This molecule features a nonane backbone, which is a nine-carbon chain, and is substituted with two methyl groups at the 4th and 6th positions, as well as a hydroxyl group at the 7th position. The presence of the ketone group at the 3rd position contributes to its reactivity and potential applications in organic synthesis. The hydroxyl group imparts alcohol-like properties, influencing its solubility and polarity. This compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and biochemistry. Its structural features suggest potential uses in fragrance, flavoring, or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C11H22O2
InChI:InChI=1/C11H22O2/c1-5-10(12)8(3)7-9(4)11(13)6-2/h8-10,12H,5-7H2,1-4H3
SMILES:CCC(C(C)CC(C)C(=O)CC)O
Synonyms:- 7-Hydroxy-4,6-dimethyl-3-nonanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Serricornin (Mixture of Isomers)
CAS:Controlled ProductApplications The sex pheromone of Cigarette Beetle.
Formula:C11H22O2Color and Shape:NeatMolecular weight:186.29
