CAS 725226-36-8

2-[[(3,4-Dichlorophenyl)methyl]thio]acetic acid hydrazide

Description:

2-[[(3,4-Dichlorophenyl)methyl]thio]acetic acid hydrazide is a chemical compound characterized by its unique structure, which includes a hydrazide functional group linked to a thioacetic acid moiety. The presence of the 3,4-dichlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant pharmacological properties. This compound is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of both hydrophilic (the hydrazide and carboxylic acid functionalities) and hydrophobic (the aromatic ring) components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound may also exhibit specific reactivity patterns typical of hydrazides, such as forming hydrazones or undergoing oxidation. Safety and handling precautions should be observed, as with many organic compounds, particularly those containing halogens and reactive functional groups. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₉H₁₀Cl₂N₂OS

InChI: InChI=1S/C9H10Cl2N2OS/c10-7-2-1-6(3-8(7)11)4-15-5-9(14)13-12/h1-3H,4-5,12H2,(H,13,14)

InChI key: InChIKey=AOQQPIJOMBEFAO-UHFFFAOYSA-N

SMILES: C(SCC(NN)=O)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• Acetic acid, [[(3,4-dichlorophenyl)methyl]thio]-, hydrazide
• 2-[[(3,4-Dichlorophenyl)methyl]thio]acetic acid hydrazide
• Acetic acid, 2-[[(3,4-dichlorophenyl)methyl]thio]-, hydrazide