CAS 725227-04-3

2-Amino-N-(4-chlorophenyl)-6-(1,1-dimethylpropyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide

Description:

2-Amino-N-(4-chlorophenyl)-6-(1,1-dimethylpropyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide, with CAS number 725227-04-3, is a synthetic organic compound characterized by its complex structure, which includes a benzo[b]thiophene core. This compound features an amino group and a carboxamide functional group, contributing to its potential biological activity. The presence of a 4-chlorophenyl substituent and a bulky 1,1-dimethylpropyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. The tetrahydrobenzo[b]thiophene moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its unique structural features may confer specific binding affinities and activities, which are often explored in drug development. As with many compounds in this class, understanding its solubility, stability, and reactivity is crucial for applications in pharmaceuticals or agrochemicals. Safety and handling considerations should also be taken into account, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₂₀H₂₅ClN₂OS

InChI: InChI=1S/C20H25ClN2OS/c1-4-20(2,3)12-5-10-15-16(11-12)25-18(22)17(15)19(24)23-14-8-6-13(21)7-9-14/h6-9,12H,4-5,10-11,22H2,1-3H3,(H,23,24)

InChI key: InChIKey=PGDACKXOKLZAAW-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(Cl)C=C1)(=O)C=2C3=C(CC(C(CC)(C)C)CC3)SC2N