CymitQuimica logo

CAS 725234-40-2

:

6-bromoimidazo[1,2-a]pyridine-2-carboxylic acid

Description:
6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position enhances its reactivity and can influence its biological activity. The carboxylic acid functional group at the 2-position is polar and can participate in hydrogen bonding, making the compound soluble in polar solvents. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine atom and the carboxylic acid group, which can affect its interactions in biological systems. Overall, 6-bromoimidazo[1,2-a]pyridine-2-carboxylic acid is a significant compound in the field of chemistry with potential applications in drug discovery and development.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-5-1-2-7-10-6(8(12)13)4-11(7)3-5/h1-4H,(H,12,13)
SMILES:c1cc2nc(cn2cc1Br)C(=O)O
Synonyms:
  • Imidazo[1,2-A]Pyridine-2-Carboxylic Acid, 6-Bromo-
  • T56 An Dnj Cvq He
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.