CAS 725234-43-5

N-(3,5-Dimethylphenyl)-<span class="text-smallcaps">L</span>-alanine

Description:

N-(3,5-Dimethylphenyl)-L-alanine, with the CAS number 725234-43-5, is an amino acid derivative characterized by the presence of a 3,5-dimethylphenyl group attached to the amino acid L-alanine. This compound features a chiral center, which contributes to its potential biological activity and interactions. The presence of the dimethylphenyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. As an amino acid derivative, it may participate in various biochemical processes, including protein synthesis and enzyme activity modulation. The compound's structure suggests it could be of interest in pharmaceutical research, particularly in the development of new drugs or as a biochemical probe. Its stability, reactivity, and interactions with other biomolecules would depend on the specific conditions, such as pH and temperature. Overall, N-(3,5-Dimethylphenyl)-L-alanine represents a unique compound with potential applications in medicinal chemistry and biochemistry.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1S/C11H15NO2/c1-7-4-8(2)6-10(5-7)12-9(3)11(13)14/h4-6,9,12H,1-3H3,(H,13,14)/t9-/m0/s1

InChI key: InChIKey=HAGIIYMZPYANKO-VIFPVBQESA-N

SMILES: N([C@H](C(O)=O)C)C1=CC(C)=CC(C)=C1

Synonyms:

• N-(3,5-Dimethylphenyl)-L-alanine
• L-Alanine, N-(3,5-dimethylphenyl)-
• 2-(3,5-DIMETHYL-PHENYLAMINO)-PROPIONIC ACID