CymitQuimica logo

CAS 725234-47-9

:

N-(2-Fluorophenyl)-2-methylalanine

Description:
N-(2-Fluorophenyl)-2-methylalanine, with the CAS number 725234-47-9, is an amino acid derivative characterized by the presence of a fluorophenyl group attached to the nitrogen of the amino group. This compound features a chiral center at the alpha carbon, which contributes to its potential biological activity and specificity in interactions with biological targets. The fluorine atom in the 2-position of the phenyl ring can influence the compound's lipophilicity and electronic properties, potentially enhancing its pharmacological profile. As an amino acid derivative, it contains both an amine and a carboxylic acid functional group, allowing it to participate in various chemical reactions, including peptide bond formation. The presence of the methyl group at the alpha position may affect its steric hindrance and solubility. Overall, N-(2-Fluorophenyl)-2-methylalanine is of interest in medicinal chemistry and drug design, particularly in the development of compounds with specific biological activities.
Formula:C10H12FNO2
InChI:InChI=1S/C10H12FNO2/c1-10(2,9(13)14)12-8-6-4-3-5-7(8)11/h3-6,12H,1-2H3,(H,13,14)
InChI key:InChIKey=NAJJRLSECXWCFB-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)(C)C)C1=C(F)C=CC=C1
Synonyms:
  • N-(2-Fluorophenyl)-2-methylalanine
  • Alanine, N-(2-fluorophenyl)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.