CAS 725252-83-5

1-[(2-Fluorophenyl)amino]cyclohexanecarboxylic acid

Description:

1-[(2-Fluorophenyl)amino]cyclohexanecarboxylic acid, identified by its CAS number 725252-83-5, is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with an amino group and a carboxylic acid functional group. The presence of the 2-fluorophenyl moiety introduces a fluorine atom, which can influence the compound's electronic properties and biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the cyclohexane ring contributes to its hydrophobic characteristics. The amino group can participate in hydrogen bonding, enhancing its potential interactions in biological systems. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential activity against various biological targets. Additionally, the fluorine substitution can enhance metabolic stability and lipophilicity, making it a valuable candidate for further research in drug development and related fields.

Formula: C₁₃H₁₆FNO₂

InChI: InChI=1S/C13H16FNO2/c14-10-6-2-3-7-11(10)15-13(12(16)17)8-4-1-5-9-13/h2-3,6-7,15H,1,4-5,8-9H2,(H,16,17)

InChI key: InChIKey=ZKXKMSMSLQWXHE-UHFFFAOYSA-N

SMILES: N(C1(C(O)=O)CCCCC1)C2=C(F)C=CC=C2

Synonyms:

• Cyclohexanecarboxylic acid, 1-[(2-fluorophenyl)amino]-
• 1-[(2-Fluorophenyl)amino]cyclohexanecarboxylic acid