
CAS 725252-86-8
:1-[(3,5-Dimethylphenyl)amino]cyclohexanecarboxylic acid
Description:
1-[(3,5-Dimethylphenyl)amino]cyclohexanecarboxylic acid, with the CAS number 725252-86-8, is an organic compound characterized by its cyclohexane backbone substituted with an amino group and a carboxylic acid functional group. The presence of the 3,5-dimethylphenyl group contributes to its hydrophobic characteristics, while the amino and carboxylic acid groups introduce polar functionalities, allowing for potential interactions in biological systems. This compound may exhibit properties such as solubility in organic solvents and limited solubility in water, typical of compounds with large hydrophobic regions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both amine and carboxylic acid functionalities, which can participate in hydrogen bonding and ionic interactions. Additionally, the specific arrangement of substituents may influence its biological activity, making it a candidate for further investigation in drug design and development. As with many organic compounds, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C15H21NO2
InChI:InChI=1S/C15H21NO2/c1-11-8-12(2)10-13(9-11)16-15(14(17)18)6-4-3-5-7-15/h8-10,16H,3-7H2,1-2H3,(H,17,18)
InChI key:InChIKey=ZZCKRRVKAZWIGW-UHFFFAOYSA-N
SMILES:N(C1(C(O)=O)CCCCC1)C2=CC(C)=CC(C)=C2
Synonyms:- 1-[(3,5-Dimethylphenyl)amino]cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 1-[(3,5-dimethylphenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.