CAS 725252-87-9

1-[(2-Methoxyphenyl)amino]cyclohexanecarboxylic acid

Description:

1-[(2-Methoxyphenyl)amino]cyclohexanecarboxylic acid, identified by its CAS number 725252-87-9, is an organic compound characterized by its unique structure that includes a cyclohexane ring, an amino group, and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility and reactivity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, potentially acting as a weak acid. The methoxy group may enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the amino group can engage in hydrogen bonding, affecting the compound's interactions with other molecules. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activities and applications would require further investigation.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1S/C14H19NO3/c1-18-12-8-4-3-7-11(12)15-14(13(16)17)9-5-2-6-10-14/h3-4,7-8,15H,2,5-6,9-10H2,1H3,(H,16,17)

InChI key: InChIKey=AHLNXIFATXWNHW-UHFFFAOYSA-N

SMILES: N(C1(C(O)=O)CCCCC1)C2=C(OC)C=CC=C2

Synonyms:

• Cyclohexanecarboxylic acid, 1-[(2-methoxyphenyl)amino]-
• 1-[(2-Methoxyphenyl)amino]cyclohexanecarboxylic acid