
CAS 725252-89-1
:α-[(2-Fluorophenyl)amino]benzeneacetic acid
Description:
α-[(2-Fluorophenyl)amino]benzeneacetic acid, identified by its CAS number 725252-89-1, is an organic compound characterized by its aromatic structure and the presence of both an amino group and a carboxylic acid functional group. This compound features a fluorinated phenyl ring, which can influence its chemical reactivity and biological activity due to the electronegative fluorine atom. The amino group is typically basic and can participate in hydrogen bonding, while the carboxylic acid group is acidic and can donate protons in solution. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can be affected by the pH of the environment and the presence of other functional groups. Additionally, the fluorine substitution may enhance lipophilicity, potentially influencing the compound's pharmacokinetics and interaction with biological targets. Overall, α-[(2-Fluorophenyl)amino]benzeneacetic acid is a compound of interest for further study in various chemical and biological contexts.
Formula:C14H12FNO2
InChI:InChI=1S/C14H12FNO2/c15-11-8-4-5-9-12(11)16-13(14(17)18)10-6-2-1-3-7-10/h1-9,13,16H,(H,17,18)
InChI key:InChIKey=QOMDNBHCQRQCBD-UHFFFAOYSA-N
SMILES:C(NC1=C(F)C=CC=C1)(C(O)=O)C2=CC=CC=C2
Synonyms:- (2-Fluoro-phenylamino)-phenyl-acetic acid
- Benzeneacetic acid, α-[(2-fluorophenyl)amino]-
- α-[(2-Fluorophenyl)amino]benzeneacetic acid
- 2-[(2-Fluorophenyl)amino]-2-phenylacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.