CAS 725252-92-6

N,N-Bis(4-methylphenyl)glycine

Description:

N,N-Bis(4-methylphenyl)glycine is an organic compound characterized by its structure, which features a glycine backbone substituted with two 4-methylphenyl groups. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic substituents. It possesses both amine and carboxylic acid functional groups, which can participate in hydrogen bonding, influencing its reactivity and interactions in various chemical environments. The presence of the methyl groups on the phenyl rings enhances its lipophilicity and may affect its biological activity. N,N-Bis(4-methylphenyl)glycine is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions, making it essential to refer to detailed experimental data for precise applications.

Formula: C₁₆H₁₇NO₂

InChI: InChI=1S/C16H17NO2/c1-12-3-7-14(8-4-12)17(11-16(18)19)15-9-5-13(2)6-10-15/h3-10H,11H2,1-2H3,(H,18,19)

InChI key: InChIKey=JBZXVWYJEFXXTL-UHFFFAOYSA-N

SMILES: N(CC(O)=O)(C1=CC=C(C)C=C1)C2=CC=C(C)C=C2

Synonyms:

• N,N-Bis(4-methylphenyl)glycine
• Glycine, N,N-bis(4-methylphenyl)-