CAS 725253-05-4

4-Chloro-α-[(4-fluorophenyl)amino]benzeneacetic acid

Description:

4-Chloro-α-[(4-fluorophenyl)amino]benzeneacetic acid, with the CAS number 725253-05-4, is a chemical compound characterized by its aromatic structure and the presence of both chlorine and fluorine substituents. This compound features a benzene ring substituted with a chloro group and an amino group attached to another phenyl ring that also carries a fluorine atom. The presence of the carboxylic acid functional group (-COOH) contributes to its acidic properties, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The specific arrangement of substituents can affect the compound's pharmacokinetics and pharmacodynamics, potentially impacting its efficacy and safety profile. Additionally, the presence of halogens like chlorine and fluorine often enhances lipophilicity, which can influence the compound's interaction with biological membranes. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development.

Formula: C₁₄H₁₁ClFNO₂

InChI: InChI=1S/C14H11ClFNO2/c15-10-3-1-9(2-4-10)13(14(18)19)17-12-7-5-11(16)6-8-12/h1-8,13,17H,(H,18,19)

InChI key: InChIKey=WGJQEOYZFXXWBI-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(F)C=C1)(C(O)=O)C2=CC=C(Cl)C=C2

Synonyms:

• (4-Chloro-phenyl)-(4-fluoro-phenylamino)-acetic acid
• 2-(4-Chlorophenyl)-2-[(4-fluorophenyl)amino]acetic acid
• Benzeneacetic acid, 4-chloro-α-[(4-fluorophenyl)amino]-
• 4-Chloro-α-[(4-fluorophenyl)amino]benzeneacetic acid