CAS 725253-06-5

4-Chloro-α-[(2-fluorophenyl)amino]benzeneacetic acid

Description:

4-Chloro-α-[(2-fluorophenyl)amino]benzeneacetic acid, with the CAS number 725253-06-5, is a chemical compound characterized by its aromatic structure and the presence of both a chloro and a fluorine substituent. This compound features a benzene ring with a chloro group at the para position and an amino group attached to a phenyl ring that is further substituted with a fluorine atom. The presence of the carboxylic acid functional group contributes to its acidic properties, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of halogen atoms often enhances the lipophilicity and metabolic stability of the compound. Overall, 4-Chloro-α-[(2-fluorophenyl)amino]benzeneacetic acid is a compound of interest in both synthetic chemistry and medicinal chemistry contexts.

Formula: C₁₄H₁₁ClFNO₂

InChI: InChI=1S/C14H11ClFNO2/c15-10-7-5-9(6-8-10)13(14(18)19)17-12-4-2-1-3-11(12)16/h1-8,13,17H,(H,18,19)

InChI key: InChIKey=SMBRZKRAJHJDHA-UHFFFAOYSA-N

SMILES: C(NC1=C(F)C=CC=C1)(C(O)=O)C2=CC=C(Cl)C=C2

Synonyms:

• Benzeneacetic acid, 4-chloro-α-[(2-fluorophenyl)amino]-
• (4-Chloro-phenyl)-(2-fluoro-phenylamino)-acetic acid
• 2-(4-Chlorophenyl)-2-[(2-fluorophenyl)amino]acetic acid
• 4-Chloro-α-[(2-fluorophenyl)amino]benzeneacetic acid