CAS 725253-08-7

4-Chloro-α-[(3-methoxyphenyl)amino]benzeneacetic acid

Description:

4-Chloro-α-[(3-methoxyphenyl)amino]benzeneacetic acid, with the CAS number 725253-08-7, is a chemical compound that belongs to the class of aromatic amino acids. It features a chloro substituent on the benzene ring and an acetic acid functional group, which contributes to its potential as a bioactive molecule. The presence of the methoxyphenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structure suggests that it could interact with biological targets, possibly influencing pathways related to inflammation or cancer. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety and handling precautions are essential when working with this substance, as it may pose health risks if not managed properly. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.

Formula: C₁₅H₁₄ClNO₃

InChI: InChI=1S/C15H14ClNO3/c1-20-13-4-2-3-12(9-13)17-14(15(18)19)10-5-7-11(16)8-6-10/h2-9,14,17H,1H3,(H,18,19)

InChI key: InChIKey=QPNLKPVZIGLGST-UHFFFAOYSA-N

SMILES: C(NC1=CC(OC)=CC=C1)(C(O)=O)C2=CC=C(Cl)C=C2

Synonyms:

• Benzeneacetic acid, 4-chloro-α-[(3-methoxyphenyl)amino]-
• 4-Chloro-α-[(3-methoxyphenyl)amino]benzeneacetic acid