CAS 725253-26-9

6-Bromo-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde

Description:

6-Bromo-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde is a chemical compound characterized by its complex structure, which includes an imidazopyridine core, a bromine substituent, and a carboxaldehyde functional group. This compound features a fused bicyclic system that contributes to its potential biological activity. The presence of the 3,4-dimethoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. The bromine atom introduces a halogen, which can affect the compound's reactivity and stability. As an aldehyde, it possesses a reactive carbonyl group, making it suitable for various chemical transformations. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with specific biological pathways. Its unique combination of functional groups suggests potential applications in drug discovery, particularly in targeting specific receptors or enzymes. However, detailed studies on its biological activity and safety profile would be necessary to fully understand its potential applications.

Formula: C₁₆H₁₃BrN₂O₃

InChI: InChI=1S/C16H13BrN2O3/c1-21-13-5-3-10(7-14(13)22-2)16-12(9-20)19-8-11(17)4-6-15(19)18-16/h3-9H,1-2H3

InChI key: InChIKey=RAEKJPIFSUEFNH-UHFFFAOYSA-N

SMILES: C(=O)C1=C(N=C2N1C=C(Br)C=C2)C3=CC(OC)=C(OC)C=C3

Synonyms:

• 6-Bromo-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde
• Imidazo[1,2-a]pyridine-3-carboxaldehyde, 6-bromo-2-(3,4-dimethoxyphenyl)-