CAS 7254-11-7
:4-chloro-6-methoxy-1,3,5-triazin-2-amine
Description:
4-Chloro-6-methoxy-1,3,5-triazin-2-amine, with the CAS number 7254-11-7, is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features a chlorine atom and a methoxy group (-OCH3) attached to the triazine ring, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the methoxy group. The chlorine substituent can influence its biological activity and reactivity, making it of interest in various fields, including agrochemicals and pharmaceuticals. The compound may also participate in nucleophilic substitution reactions due to the presence of the amine group, which can act as a nucleophile. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, 4-chloro-6-methoxy-1,3,5-triazin-2-amine is a versatile compound with potential applications in synthetic chemistry and material science.
Formula:C4H5ClN4O
InChI:InChI=1/C4H5ClN4O/c1-10-4-8-2(5)7-3(6)9-4/h1H3,(H2,6,7,8,9)
Synonyms:- 1,3,5-triazin-2-amine, 4-chloro-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.