CAS 7254-13-9

N-{5-[(4-nitrophenyl)sulfanyl]-1,3-thiazol-2-yl}acetamide

Description:

N-{5-[(4-nitrophenyl)sulfanyl]-1,3-thiazol-2-yl}acetamide is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a nitrophenyl group indicates that the compound has a phenyl ring substituted with a nitro group, which can influence its electronic properties and reactivity. The sulfanyl group (–S–) attached to the thiazole enhances the compound's potential for various chemical interactions, including nucleophilic substitutions. Acetamide functionality suggests that the compound may exhibit amide characteristics, such as hydrogen bonding capabilities. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to biological activity. Its properties, such as solubility, stability, and reactivity, can be influenced by the functional groups present, making it a candidate for further research in drug development or as a chemical intermediate. Safety and handling precautions should be observed, as compounds with nitro groups can be sensitive and potentially hazardous.

Formula: C₁₁H₉N₃O₃S₂

InChI: InChI=1/C11H9N3O3S2/c1-7(15)13-11-12-6-10(19-11)18-9-4-2-8(3-5-9)14(16)17/h2-6H,1H3,(H,12,13,15)

SMILES: CC(=Nc1ncc(Sc2ccc(cc2)N(=O)=O)s1)O

Synonyms:

• acetamide, N-[5-[(4-nitrophenyl)thio]-2-thiazolyl]-