CAS 7254-15-1

N,N'-bis(pyridin-4-ylmethyl)ethane-1,2-diamine

Description:

N,N'-bis(pyridin-4-ylmethyl)ethane-1,2-diamine, with the CAS number 7254-15-1, is a bidentate ligand characterized by its ability to coordinate with metal ions through its amine and pyridine functional groups. This compound features two pyridine rings attached to a central ethane-1,2-diamine backbone, enhancing its chelating properties. The presence of the pyridine moieties contributes to its aromatic character, which can influence its solubility and stability in various solvents. Typically, this compound exhibits good thermal stability and can form stable complexes with transition metals, making it useful in coordination chemistry and catalysis. Its structure allows for potential applications in fields such as medicinal chemistry, where it may serve as a scaffold for drug development or as a ligand in metal-based therapies. Additionally, the compound's ability to engage in hydrogen bonding and π-π stacking interactions can further enhance its reactivity and functionality in various chemical environments.

Formula: C₁₄H₁₈N₄

InChI: InChI=1/C14H18N4/c1-5-15-6-2-13(1)11-17-9-10-18-12-14-3-7-16-8-4-14/h1-8,17-18H,9-12H2

N1,N2-Bis(pyridin-4-ylmethyl)ethane-1,2-diamine

CAS: 7254-15-1

N1,N2-Bis(pyridin-4-ylmethyl)ethane-1,2-diamine

Purity: 95%

Molecular weight: 242.33g/mol

Ref: 54-OR1071540