CAS 72542-80-4

5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid

Description:

5-(4-Fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. The presence of the 4-fluorophenyl group contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. This compound features a carboxylic acid functional group, which can participate in hydrogen bonding and may influence its acidity and reactivity in chemical reactions. The oxadiazole moiety is known for its applications in pharmaceuticals and materials science, often exhibiting interesting biological activities and photophysical properties. The compound's structure suggests potential uses in drug development, particularly in the design of bioactive molecules. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable component in medicinal chemistry. Overall, 5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid is a versatile compound with significant implications in various fields of research.

Formula: C₉H₅FN₂O₃

InChI: InChI=1/C9H5FN2O3/c10-6-3-1-5(2-4-6)8-11-7(9(13)14)12-15-8/h1-4H,(H,13,14)

Synonyms:

• 1,2,4-Oxadiazole-3-Carboxylic Acid, 5-(4-Fluorophenyl)-
• 5-(4-FLUOROPHENYL)-1,2,4-OXADIAZOLE-3-CARBOXYLIC ACID