CymitQuimica logo

CAS 72545-66-5

:

2-Furanmethanamine,5-[[(2-aminoethyl)thio]methyl]-N,N-dimethyl-, hydrochloride (1:2)

Description:
2-Furanmethanamine, 5-[[(2-aminoethyl)thio]methyl]-N,N-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic heterocycle containing oxygen. This compound features a dimethylamino group and a thioether linkage, indicating the presence of sulfur in its structure. The hydrochloride form suggests that it is a salt, which typically enhances its solubility in water and stability. The presence of amino groups indicates potential basicity and reactivity, making it suitable for various applications in organic synthesis and medicinal chemistry. The compound may exhibit biological activity due to its structural features, which could interact with biological targets. As with many amines, it may also participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C10H18N2OSClH
InChI:InChI=1S/C10H18N2OS.2ClH/c1-12(2)7-9-3-4-10(13-9)8-14-6-5-11;;/h3-4H,5-8,11H2,1-2H3;2*1H
InChI key:JNTOYGBZXJSVNI-UHFFFAOYSA-N
SMILES:CN(C)CC1=CC=C(O1)CSCCN.Cl.Cl
Synonyms:
  • 2-Furanmethanamine,5-[[(2-aminoethyl)thio]methyl]-N,N-dimethyl-, dihydrochloride (9CI)
  • Cistofurdihydrochloride
Found 3 products.