CAS 7255-96-1
:(3-hydroxybenzylidene)propanedinitrile
Description:
(3-Hydroxybenzylidene)propanedinitrile, with the CAS number 7255-96-1, is an organic compound characterized by its unique structure, which includes a hydroxyl group and a benzylidene moiety linked to a propanedinitrile backbone. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and as a building block in various chemical reactions. The presence of the hydroxyl group contributes to its reactivity, allowing for hydrogen bonding and interactions with other polar substances. Additionally, the nitrile groups in the propanedinitrile portion can participate in nucleophilic addition reactions, making this compound versatile in synthetic organic chemistry. Its properties, such as solubility and melting point, can vary depending on the solvent and conditions used. Overall, (3-hydroxybenzylidene)propanedinitrile is of interest in research for its functional groups and potential applications in materials science and pharmaceuticals.
Formula:C10H6N2O
InChI:InChI=1/C10H6N2O/c11-6-9(7-12)4-8-2-1-3-10(13)5-8/h1-5,13H
SMILES:c1cc(C=C(C#N)C#N)cc(c1)O
Synonyms:- (3-Hydroxybenzylidene)malononitrile
- m-Hydroxybenzylidenemalononitrile
- Propanedinitrile, 2-[(3-Hydroxyphenyl)Methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
