CAS 72560-69-1
:3'-O-acetyl-2'-deoxycytidine
Description:
3'-O-acetyl-2'-deoxycytidine is a nucleoside analog characterized by the presence of an acetyl group at the 3' position of the ribose sugar and a deoxycytidine base. This compound is notable for its role in biochemical research and potential therapeutic applications, particularly in the field of antiviral and anticancer drug development. The acetylation at the 3' position can influence the compound's solubility, stability, and interaction with biological targets, such as nucleic acids and enzymes. As a nucleoside, it consists of a pyrimidine base (cytosine) linked to a sugar moiety (deoxyribose), which is essential for its incorporation into nucleic acid structures. The CAS number 72560-69-1 uniquely identifies this compound in chemical databases, facilitating its study and application in various scientific contexts. Overall, 3'-O-acetyl-2'-deoxycytidine serves as an important tool in molecular biology and medicinal chemistry, contributing to the understanding of nucleoside function and the development of novel therapeutic agents.
Formula:C11H15N3O5
InChI:InChI=1/C11H15N3O5/c1-6(16)18-7-4-10(19-8(7)5-15)14-3-2-9(12)13-11(14)17/h2-3,7-8,10,15H,4-5H2,1H3,(H2,12,13,17)
SMILES:CC(=O)OC1CC(n2ccc(=N)nc2O)OC1CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2r,3s,5r)-5-(4-Amino-2-oxopyrimidin-1(2h)-yl)-2-(hydroxymethyl)tetrahydrofuran-3-yl acetate
CAS:(2r,3s,5r)-5-(4-Amino-2-oxopyrimidin-1(2h)-yl)-2-(hydroxymethyl)tetrahydrofuran-3-yl acetatePurity:98%3'-O-Acetyl-2'-deoxycytidine
CAS:<p>3'-O-acetyl-2'-deoxycytidine is an activator that can be used in the synthesis of deoxyribonucleosides and nucleosides. It is a novel, modified, and high purity chemical entity that has shown anticancer and antiviral properties. 3'-O-acetyl-2'-deoxycytidine is a monophosphate nucleotide, which can be used in the synthesis of various pharmaceuticals. This product has been synthesized using high quality reagents in order to provide the best possible product for research purposes.</p>Formula:C11H15N3O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:269.25 g/mol(2R,3S,5R)-5-(4-Amino-2-oxopyrimidin-1(2H)-yl)-2-(hydroxymethyl)tetrahydrofuran-3-yl acetate
CAS:Purity:98%Molecular weight:269.101
