
CAS 72561-51-4
:5-Chloro-1H-indol-3-amine
Description:
5-Chloro-1H-indol-3-amine, with the CAS number 72561-51-4, is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 5-position and an amino group at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific conditions. It is often used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, particularly in the development of compounds targeting various biological pathways. The amino group can participate in hydrogen bonding and nucleophilic reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C8H7ClN2
InChI:InChI=1S/C8H7ClN2/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-4,11H,10H2
InChI key:InChIKey=ARLLZELGJFWSQA-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC=C(Cl)C2)NC1
Synonyms:- 3-Amino-5-chloroindole
- 1H-Indol-3-amine, 5-chloro-
- 5-Chloro-1H-indol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
