CAS 725687-85-4

7,8-Dimethyl-2-(5-methyl-2-furanyl)-4-quinolinecarboxylic acid

Description:

7,8-Dimethyl-2-(5-methyl-2-furanyl)-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with methyl groups and a furan moiety. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or anticancer effects, although specific biological data may vary. The presence of the furan ring contributes to its reactivity and potential for forming various derivatives. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. Additionally, the methyl substitutions can affect the compound's steric and electronic properties, potentially impacting its pharmacokinetics and pharmacodynamics. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, 7,8-Dimethyl-2-(5-methyl-2-furanyl)-4-quinolinecarboxylic acid represents a class of compounds with diverse applications in medicinal chemistry and material science.

Formula: C₁₇H₁₅NO₃

InChI: InChI=1S/C17H15NO3/c1-9-4-6-12-13(17(19)20)8-14(18-16(12)11(9)3)15-7-5-10(2)21-15/h4-8H,1-3H3,(H,19,20)

InChI key: InChIKey=TUQWVAUXLQTYPA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C=3OC(C)=CC3)C(C)=C(C)C=C2

Synonyms:

• 7,8-Dimethyl-2-(5-methyl-2-furanyl)-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 7,8-dimethyl-2-(5-methyl-2-furanyl)-