CAS 725687-86-5

8-Ethyl-2-(2-methylphenyl)-4-quinolinecarboxylic acid

Description:

8-Ethyl-2-(2-methylphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an ethyl group at the 8-position and a 2-methylphenyl group at the 2-position of the quinoline ring, contributing to its unique chemical properties and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The compound is likely to exhibit properties typical of quinoline derivatives, such as fluorescence and potential antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its specific applications and behavior in various environments would depend on further studies, including its stability, reactivity, and interactions with other molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₁₇NO₂

InChI: InChI=1S/C19H17NO2/c1-3-13-8-6-10-15-16(19(21)22)11-17(20-18(13)15)14-9-5-4-7-12(14)2/h4-11H,3H2,1-2H3,(H,21,22)

InChI key: InChIKey=GITXONJUANHELJ-UHFFFAOYSA-N

SMILES: C(C)C=1C2=C(C(C(O)=O)=CC(=N2)C3=C(C)C=CC=C3)C=CC1

Synonyms:

• 8-Ethyl-2-(2-methylphenyl)-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 8-ethyl-2-(2-methylphenyl)-
• 8-ethyl-2-(2-methylphenyl)quinoline-4-carboxylic acid
• 8-Ethyl-2-(o-tolyl)quinoline-4-carboxylic acid