CAS 725687-88-7

2-(3-Bromophenyl)-6-methyl-4-quinolinecarboxylic acid

Description:

2-(3-Bromophenyl)-6-methyl-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromophenyl group at the 2-position and a carboxylic acid functional group at the 4-position of the quinoline ring, contributing to its potential reactivity and solubility properties. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The methyl group at the 6-position can influence the compound's steric and electronic properties, potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₁₇H₁₂BrNO₂

InChI: InChI=1S/C17H12BrNO2/c1-10-5-6-15-13(7-10)14(17(20)21)9-16(19-15)11-3-2-4-12(18)8-11/h2-9H,1H3,(H,20,21)

InChI key: InChIKey=NSINEIFLWDUHLP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC(Br)=CC=C3)C=CC(C)=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 2-(3-bromophenyl)-6-methyl-
• 2-(3-Bromophenyl)-6-methyl-4-quinolinecarboxylic acid