CAS 72569-66-5

methyl 2,3-anhydro-4,5-dideoxy-4-ethyl-3-methylpentonate

Description:

Methyl 2,3-anhydro-4,5-dideoxy-4-ethyl-3-methylpentonate, identified by its CAS number 72569-66-5, is a chemical compound that belongs to the class of sugar derivatives. It features a unique anhydro structure, indicating the absence of a water molecule that typically connects two hydroxyl groups in sugars. This compound is characterized by its complex molecular framework, which includes a pentonate backbone with ethyl and methyl substituents, contributing to its distinct chemical properties. The presence of an anhydro group suggests potential reactivity, particularly in glycosylation reactions or as a precursor in synthetic organic chemistry. Its methyl ester functionality indicates that it can participate in esterification and transesterification reactions. Methyl 2,3-anhydro-4,5-dideoxy-4-ethyl-3-methylpentonate may exhibit solubility in organic solvents, making it useful in various chemical applications, including pharmaceuticals and biochemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₉H₁₆O₃

InChI: InChI=1/C9H16O3/c1-5-6(2)9(3)7(12-9)8(10)11-4/h6-7H,5H2,1-4H3

SMILES: CCC(C)C1(C)C(C(=O)OC)O1

Synonyms:

• Oxiranecarboxylic acid, 3-methyl-3- (1-methylpropyl)-, methyl ester
• pentonic acid, 2,3-anhydro-4,5-dideoxy-4-ethyl-3-C-methyl-, methyl ester
• Methyl 2,3-anhydro-4,5-dideoxy-4-ethyl-3-methylpentonate